C11H10S2 — CID 12630081
4,7-dimethylthiochromene-2-thione (PubChem CID 12630081) has the molecular formula C11H10S2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4,7-dimethylthiochromene-2-thione.
| Compound Name | 4,7-dimethylthiochromene-2-thione |
|---|---|
| PubChem CID | 12630081 |
| Molecular Formula | C11H10S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 4,7-dimethylthiochromene-2-thione |
| SMILES | Cc1ccc2c(C)cc(=S)sc2c1 |
| InChI | InChI=1S/C11H10S2/c1-7-3-4-9-8(2)6-11(12)13-10(9)5-7/h3-6H,1-2H3 |
| InChIKey | VZZNFXINDHYBEV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|