C33H44N2SSi2 — CID 176855311
dicyclohexyl-methyl-[7-methyl-4-(4-trimethylsilylnaphthalen-2-yl)thieno[3,2-d]pyrimidin-6-yl]silane (PubChem CID 176855311) has the molecular formula C33H44N2SSi2 and a molecular weight of 556.97 g/mol. Its IUPAC name is dicyclohexyl-methyl-[7-methyl-4-(4-trimethylsilylnaphthalen-2-yl)thieno[3,2-d]pyrimidin-6-yl]silane.
| Compound Name | dicyclohexyl-methyl-[7-methyl-4-(4-trimethylsilylnaphthalen-2-yl)thieno[3,2-d]pyrimidin-6-yl]silane |
|---|---|
| PubChem CID | 176855311 |
| Molecular Formula | C33H44N2SSi2 |
| Molecular Weight | 556.97 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | dicyclohexyl-methyl-[7-methyl-4-(4-trimethylsilylnaphthalen-2-yl)thieno[3,2-d]pyrimidin-6-yl]silane |
| SMILES | Cc1c([Si](C)(C2CCCCC2)C2CCCCC2)sc2c(-c3cc([Si](C)(C)C)c4ccccc4c3)ncnc12 |
| InChI | InChI=1S/C33H44N2SSi2/c1-23-30-32(36-33(23)38(5,26-15-8-6-9-16-26)27-17-10-7-11-18-27)31(35-22-34-30)25-20-24-14-12-13-19-28(24)29(21-25)37(2,3)4/h12-14,19-22,26-27H,6-11,15-18H2,1-5H3 |
| InChIKey | YLOVOIGDTGUXSO-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.97 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|