C32H46N2OSi2 — CID 176855366
trimethyl-[3-[7-methyl-6-[tris(2-methylpropyl)silyl]furo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane (PubChem CID 176855366) has the molecular formula C32H46N2OSi2 and a molecular weight of 530.91 g/mol. Its IUPAC name is trimethyl-[3-[7-methyl-6-[tris(2-methylpropyl)silyl]furo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane.
| Compound Name | trimethyl-[3-[7-methyl-6-[tris(2-methylpropyl)silyl]furo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane |
|---|---|
| PubChem CID | 176855366 |
| Molecular Formula | C32H46N2OSi2 |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | trimethyl-[3-[7-methyl-6-[tris(2-methylpropyl)silyl]furo[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane |
| SMILES | Cc1c([Si](CC(C)C)(CC(C)C)CC(C)C)oc2c(-c3cc([Si](C)(C)C)c4ccccc4c3)ncnc12 |
| InChI | InChI=1S/C32H46N2OSi2/c1-21(2)17-37(18-22(3)4,19-23(5)6)32-24(7)29-31(35-32)30(34-20-33-29)26-15-25-13-11-12-14-27(25)28(16-26)36(8,9)10/h11-16,20-23H,17-19H2,1-10H3 |
| InChIKey | BHFMTBZVVIAUST-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|