C24H22FNOSSi — CID 177073393
[3-(12-fluoro-4,5-dimethyl-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-9-yl)naphthalen-1-yl]-trimethylsilane (PubChem CID 177073393) has the molecular formula C24H22FNOSSi and a molecular weight of 419.60 g/mol. Its IUPAC name is [3-(12-fluoro-4,5-dimethyl-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-9-yl)naphthalen-1-yl]-trimethylsilane.
| Compound Name | [3-(12-fluoro-4,5-dimethyl-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-9-yl)naphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177073393 |
| Molecular Formula | C24H22FNOSSi |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [3-(12-fluoro-4,5-dimethyl-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-9-yl)naphthalen-1-yl]-trimethylsilane |
| SMILES | Cc1oc2c(sc3c(-c4cc([Si](C)(C)C)c5ccccc5c4)ncc(F)c32)c1C |
| InChI | InChI=1S/C24H22FNOSSi/c1-13-14(2)27-22-20-18(25)12-26-21(24(20)28-23(13)22)16-10-15-8-6-7-9-17(15)19(11-16)29(3,4)5/h6-12H,1-5H3 |
| InChIKey | LUBQDALAPLHXQG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|