C26H25NSi — CID 177070409
[3-(5,6-dihydrobenzo[f]quinolin-3-yl)naphthalen-1-yl]-trimethylsilane (PubChem CID 177070409) has the molecular formula C26H25NSi and a molecular weight of 379.58 g/mol. Its IUPAC name is [3-(5,6-dihydrobenzo[f]quinolin-3-yl)naphthalen-1-yl]-trimethylsilane.
| Compound Name | [3-(5,6-dihydrobenzo[f]quinolin-3-yl)naphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177070409 |
| Molecular Formula | C26H25NSi |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [3-(5,6-dihydrobenzo[f]quinolin-3-yl)naphthalen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc(-c2ccc3c(n2)CCc2ccccc2-3)cc2ccccc12 |
| InChI | InChI=1S/C26H25NSi/c1-28(2,3)26-17-20(16-19-9-5-7-11-22(19)26)24-15-13-23-21-10-6-4-8-18(21)12-14-25(23)27-24/h4-11,13,15-17H,12,14H2,1-3H3 |
| InChIKey | YTMDVPMFBVHODH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|