C24H23N3Si — CID 177070391
[3-(5,6-dihydropyrido[3,2-h]quinazolin-4-yl)naphthalen-1-yl]-trimethylsilane (PubChem CID 177070391) has the molecular formula C24H23N3Si and a molecular weight of 381.56 g/mol. Its IUPAC name is [3-(5,6-dihydropyrido[3,2-h]quinazolin-4-yl)naphthalen-1-yl]-trimethylsilane.
| Compound Name | [3-(5,6-dihydropyrido[3,2-h]quinazolin-4-yl)naphthalen-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177070391 |
| Molecular Formula | C24H23N3Si |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [3-(5,6-dihydropyrido[3,2-h]quinazolin-4-yl)naphthalen-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc(-c2ncnc3c2CCc2cccnc2-3)cc2ccccc12 |
| InChI | InChI=1S/C24H23N3Si/c1-28(2,3)21-14-18(13-17-7-4-5-9-19(17)21)22-20-11-10-16-8-6-12-25-23(16)24(20)27-15-26-22/h4-9,12-15H,10-11H2,1-3H3 |
| InChIKey | HSSDMKMJCBROBX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|