C27H28N2OSi — CID 170932085
trimethyl-[3-[6-(2-methylpropyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane (PubChem CID 170932085) has the molecular formula C27H28N2OSi and a molecular weight of 424.62 g/mol. Its IUPAC name is trimethyl-[3-[6-(2-methylpropyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane.
| Compound Name | trimethyl-[3-[6-(2-methylpropyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane |
|---|---|
| PubChem CID | 170932085 |
| Molecular Formula | C27H28N2OSi |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | trimethyl-[3-[6-(2-methylpropyl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]naphthalen-1-yl]silane |
| SMILES | CC(C)Cc1cccc2c1oc1c(-c3cc([Si](C)(C)C)c4ccccc4c3)ncnc12 |
| InChI | InChI=1S/C27H28N2OSi/c1-17(2)13-19-10-8-12-22-25-27(30-26(19)22)24(28-16-29-25)20-14-18-9-6-7-11-21(18)23(15-20)31(3,4)5/h6-12,14-17H,13H2,1-5H3 |
| InChIKey | YMUJLZLVLLFHKM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|