C33H31NSeSi — CID 170932157
dimethyl-[3-[8-(2-methylpropyl)-[1]benzoselenolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]-phenylsilane (PubChem CID 170932157) has the molecular formula C33H31NSeSi and a molecular weight of 548.66 g/mol. Its IUPAC name is dimethyl-[3-[8-(2-methylpropyl)-[1]benzoselenolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]-phenylsilane.
| Compound Name | dimethyl-[3-[8-(2-methylpropyl)-[1]benzoselenolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]-phenylsilane |
|---|---|
| PubChem CID | 170932157 |
| Molecular Formula | C33H31NSeSi |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | dimethyl-[3-[8-(2-methylpropyl)-[1]benzoselenolo[2,3-c]pyridin-1-yl]naphthalen-1-yl]-phenylsilane |
| SMILES | CC(C)Cc1cccc2c1[se]c1c(-c3cc([Si](C)(C)c4ccccc4)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C33H31NSeSi/c1-22(2)19-24-12-10-16-28-29-17-18-34-31(33(29)35-32(24)28)25-20-23-11-8-9-15-27(23)30(21-25)36(3,4)26-13-6-5-7-14-26/h5-18,20-22H,19H2,1-4H3 |
| InChIKey | KOZMWIAEHUMVAR-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|