C33H35NSSi — CID 170545638
6-(4-tert-butylnaphthalen-2-yl)-16,16-dimethyl-14-(2-methylpropyl)-8-thia-5-aza-16-silatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10,12,14-heptaene (PubChem CID 170545638) has the molecular formula C33H35NSSi and a molecular weight of 505.80 g/mol. Its IUPAC name is 6-(4-tert-butylnaphthalen-2-yl)-16,16-dimethyl-14-(2-methylpropyl)-8-thia-5-aza-16-silatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10,12,14-heptaene.
| Compound Name | 6-(4-tert-butylnaphthalen-2-yl)-16,16-dimethyl-14-(2-methylpropyl)-8-thia-5-aza-16-silatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10,12,14-heptaene |
|---|---|
| PubChem CID | 170545638 |
| Molecular Formula | C33H35NSSi |
| Molecular Weight | 505.80 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 6-(4-tert-butylnaphthalen-2-yl)-16,16-dimethyl-14-(2-methylpropyl)-8-thia-5-aza-16-silatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),2(7),3,5,10,12,14-heptaene |
| SMILES | CC(C)Cc1cccc2c1[Si](C)(C)c1c-2sc2c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C33H35NSSi/c1-20(2)17-22-12-10-14-25-30-32(36(6,7)31(22)25)26-15-16-34-28(29(26)35-30)23-18-21-11-8-9-13-24(21)27(19-23)33(3,4)5/h8-16,18-20H,17H2,1-7H3 |
| InChIKey | ALBVFAOVNHWDSQ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.80 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|