C23H27NSi — CID 140720405
dimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-phenylsilane (PubChem CID 140720405) has the molecular formula C23H27NSi and a molecular weight of 345.56 g/mol. Its IUPAC name is dimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-phenylsilane.
| Compound Name | dimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-phenylsilane |
|---|---|
| PubChem CID | 140720405 |
| Molecular Formula | C23H27NSi |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | dimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-phenylsilane |
| SMILES | CC(C)Cc1cc(-c2ccccc2)ncc1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H27NSi/c1-18(2)15-20-16-22(19-11-7-5-8-12-19)24-17-23(20)25(3,4)21-13-9-6-10-14-21/h5-14,16-18H,15H2,1-4H3 |
| InChIKey | KYXUCHQYGLOUSB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|