C19H25NSi — CID 140728004
4-(2-methylpropyl)-5-(1-methylsiletan-1-yl)-2-phenylpyridine (PubChem CID 140728004) has the molecular formula C19H25NSi and a molecular weight of 295.50 g/mol. Its IUPAC name is 4-(2-methylpropyl)-5-(1-methylsiletan-1-yl)-2-phenylpyridine.
| Compound Name | 4-(2-methylpropyl)-5-(1-methylsiletan-1-yl)-2-phenylpyridine |
|---|---|
| PubChem CID | 140728004 |
| Molecular Formula | C19H25NSi |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-(2-methylpropyl)-5-(1-methylsiletan-1-yl)-2-phenylpyridine |
| SMILES | CC(C)Cc1cc(-c2ccccc2)ncc1[Si]1(C)CCC1 |
| InChI | InChI=1S/C19H25NSi/c1-15(2)12-17-13-18(16-8-5-4-6-9-16)20-14-19(17)21(3)10-7-11-21/h4-6,8-9,13-15H,7,10-12H2,1-3H3 |
| InChIKey | HQQSZKPLDZRLDR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|