C30H32N2Si — CID 139035258
[6-(3-carbazol-9-ylphenyl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane (PubChem CID 139035258) has the molecular formula C30H32N2Si and a molecular weight of 448.69 g/mol. Its IUPAC name is [6-(3-carbazol-9-ylphenyl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-(3-carbazol-9-ylphenyl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 139035258 |
| Molecular Formula | C30H32N2Si |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | [6-(3-carbazol-9-ylphenyl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
| SMILES | CC(C)Cc1cc(-c2cccc(-n3c4ccccc4c4ccccc43)c2)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C30H32N2Si/c1-21(2)17-23-19-27(31-20-30(23)33(3,4)5)22-11-10-12-24(18-22)32-28-15-8-6-13-25(28)26-14-7-9-16-29(26)32/h6-16,18-21H,17H2,1-5H3 |
| InChIKey | UCSFMZQRCWAZTB-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|