C25H14N4 — CID 146543206
9-[3-(5-cyano-2-pyridinyl)phenyl]carbazole-3-carbonitrile (PubChem CID 146543206) has the molecular formula C25H14N4 and a molecular weight of 370.42 g/mol. Its IUPAC name is 9-[3-(5-cyano-2-pyridinyl)phenyl]carbazole-3-carbonitrile.
| Compound Name | 9-[3-(5-cyano-2-pyridinyl)phenyl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 146543206 |
| Molecular Formula | C25H14N4 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 9-[3-(5-cyano-2-pyridinyl)phenyl]carbazole-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2cccc(-n3c4ccccc4c4cc(C#N)ccc43)c2)nc1 |
| InChI | InChI=1S/C25H14N4/c26-14-17-9-11-25-22(12-17)21-6-1-2-7-24(21)29(25)20-5-3-4-19(13-20)23-10-8-18(15-27)16-28-23/h1-13,16H |
| InChIKey | HMMUCKJBUIXCLO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |