C26H13N5 — CID 146542629
6-[3-(3-cyanocarbazol-9-yl)phenyl]pyridine-2,4-dicarbonitrile (PubChem CID 146542629) has the molecular formula C26H13N5 and a molecular weight of 395.43 g/mol. Its IUPAC name is 6-[3-(3-cyanocarbazol-9-yl)phenyl]pyridine-2,4-dicarbonitrile.
| Compound Name | 6-[3-(3-cyanocarbazol-9-yl)phenyl]pyridine-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 146542629 |
| Molecular Formula | C26H13N5 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 6-[3-(3-cyanocarbazol-9-yl)phenyl]pyridine-2,4-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)nc(-c2cccc(-n3c4ccccc4c4cc(C#N)ccc43)c2)c1 |
| InChI | InChI=1S/C26H13N5/c27-14-17-8-9-26-23(11-17)22-6-1-2-7-25(22)31(26)21-5-3-4-19(13-21)24-12-18(15-28)10-20(16-29)30-24/h1-13H |
| InChIKey | ZMEMEWPXOROWSB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |