C34H34N2Si — CID 164706390
[6-(4-carbazol-9-ylnaphthalen-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane (PubChem CID 164706390) has the molecular formula C34H34N2Si and a molecular weight of 498.75 g/mol. Its IUPAC name is [6-(4-carbazol-9-ylnaphthalen-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-(4-carbazol-9-ylnaphthalen-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 164706390 |
| Molecular Formula | C34H34N2Si |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | [6-(4-carbazol-9-ylnaphthalen-1-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
| SMILES | CC(C)Cc1cc(-c2ccc(-n3c4ccccc4c4ccccc43)c3ccccc23)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C34H34N2Si/c1-23(2)20-24-21-30(35-22-34(24)37(3,4)5)26-18-19-33(27-13-7-6-12-25(26)27)36-31-16-10-8-14-28(31)29-15-9-11-17-32(29)36/h6-19,21-23H,20H2,1-5H3 |
| InChIKey | XLXJKLWRGOCHCK-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|