C36H34N2OSi — CID 163214388
[6-(1-carbazol-9-yldibenzofuran-4-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane (PubChem CID 163214388) has the molecular formula C36H34N2OSi and a molecular weight of 538.77 g/mol. Its IUPAC name is [6-(1-carbazol-9-yldibenzofuran-4-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-(1-carbazol-9-yldibenzofuran-4-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 163214388 |
| Molecular Formula | C36H34N2OSi |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | [6-(1-carbazol-9-yldibenzofuran-4-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
| SMILES | CC(C)Cc1cc(-c2ccc(-n3c4ccccc4c4ccccc43)c3c2oc2ccccc23)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C36H34N2OSi/c1-23(2)20-24-21-29(37-22-34(24)40(3,4)5)27-18-19-32(35-28-14-8-11-17-33(28)39-36(27)35)38-30-15-9-6-12-25(30)26-13-7-10-16-31(26)38/h6-19,21-23H,20H2,1-5H3 |
| InChIKey | BRAOBULWAUPNHQ-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|