C26H29NSi — CID 156657793
trimethyl-[4-(2-methylpropyl)-6-phenanthren-1-yl-3-pyridinyl]silane (PubChem CID 156657793) has the molecular formula C26H29NSi and a molecular weight of 383.61 g/mol. Its IUPAC name is trimethyl-[4-(2-methylpropyl)-6-phenanthren-1-yl-3-pyridinyl]silane.
| Compound Name | trimethyl-[4-(2-methylpropyl)-6-phenanthren-1-yl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 156657793 |
| Molecular Formula | C26H29NSi |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | trimethyl-[4-(2-methylpropyl)-6-phenanthren-1-yl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2cccc3c2ccc2ccccc23)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C26H29NSi/c1-18(2)15-20-16-25(27-17-26(20)28(3,4)5)24-12-8-11-22-21-10-7-6-9-19(21)13-14-23(22)24/h6-14,16-18H,15H2,1-5H3 |
| InChIKey | NTJXPIMXTBZANR-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|