C41H44IrN2Si-2 — CID 167332148
8-tert-butyl-2-phenylbenzo[f]isoquinoline;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 167332148) has the molecular formula C41H44IrN2Si-2 and a molecular weight of 785.12 g/mol. Its IUPAC name is 8-tert-butyl-2-phenylbenzo[f]isoquinoline;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 8-tert-butyl-2-phenylbenzo[f]isoquinoline;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 167332148 |
| Molecular Formula | C41H44IrN2Si-2 |
| Molecular Weight | 785.12 g/mol |
| Exact Mass | 785.29 |
| IUPAC Name | 8-tert-butyl-2-phenylbenzo[f]isoquinoline;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)(C)c1ccc2c(ccc3cnc(-c4[c-]cccc4)cc32)c1.CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C23H20N.C18H24NSi.Ir/c1-23(2,3)19-11-12-20-17(13-19)9-10-18-15-24-22(14-21(18)20)16-7-5-4-6-8-16;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h4-7,9-15H,1-3H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | XXJOCCYZANLVQT-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.12 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|