C38H42IrN2OSi2-2 — CID 166018685
iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-6-yl)silane (PubChem CID 166018685) has the molecular formula C38H42IrN2OSi2-2 and a molecular weight of 791.16 g/mol. Its IUPAC name is iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-6-yl)silane.
| Compound Name | iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-6-yl)silane |
|---|---|
| PubChem CID | 166018685 |
| Molecular Formula | C38H42IrN2OSi2-2 |
| Molecular Weight | 791.16 g/mol |
| Exact Mass | 791.25 |
| IUPAC Name | iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane;trimethyl-(3-phenyl-[1]benzofuro[3,2-c]pyridin-6-yl)silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.C[Si](C)(C)c1cccc2c1oc1cc(-c3[c-]cccc3)ncc12.[Ir] |
| InChI | InChI=1S/C20H18NOSi.C18H24NSi.Ir/c1-23(2,3)19-11-7-10-15-16-13-21-17(12-18(16)22-20(15)19)14-8-5-4-6-9-14;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h4-8,10-13H,1-3H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | YYNTXCBBTMLDIZ-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.16 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|