C36H37NSi2 — CID 140719758
[6-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane (PubChem CID 140719758) has the molecular formula C36H37NSi2 and a molecular weight of 539.87 g/mol. Its IUPAC name is [6-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 140719758 |
| Molecular Formula | C36H37NSi2 |
| Molecular Weight | 539.87 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | [6-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
| SMILES | CC(C)Cc1cc(-c2ccc3c(c2)[Si](c2ccccc2)(c2ccccc2)c2ccccc2-3)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C36H37NSi2/c1-26(2)22-28-23-33(37-25-36(28)38(3,4)5)27-20-21-32-31-18-12-13-19-34(31)39(35(32)24-27,29-14-8-6-9-15-29)30-16-10-7-11-17-30/h6-21,23-26H,22H2,1-5H3 |
| InChIKey | GRTQUUWEVFWZFI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|