C33H31NSi2 — CID 140719840
[6-(5,5-diphenylbenzo[b][1]benzosilol-2-yl)-4-methyl-3-pyridinyl]-trimethylsilane (PubChem CID 140719840) has the molecular formula C33H31NSi2 and a molecular weight of 497.79 g/mol. Its IUPAC name is [6-(5,5-diphenylbenzo[b][1]benzosilol-2-yl)-4-methyl-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-(5,5-diphenylbenzo[b][1]benzosilol-2-yl)-4-methyl-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 140719840 |
| Molecular Formula | C33H31NSi2 |
| Molecular Weight | 497.79 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [6-(5,5-diphenylbenzo[b][1]benzosilol-2-yl)-4-methyl-3-pyridinyl]-trimethylsilane |
| SMILES | Cc1cc(-c2ccc3c(c2)-c2ccccc2[Si]3(c2ccccc2)c2ccccc2)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C33H31NSi2/c1-24-21-30(34-23-33(24)35(2,3)4)25-19-20-32-29(22-25)28-17-11-12-18-31(28)36(32,26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-23H,1-4H3 |
| InChIKey | IOOJCRMXZPBAMX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.79 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|