C28H29NSi2 — CID 140720085
[2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-5-phenyl-3-pyridinyl]-trimethylsilane (PubChem CID 140720085) has the molecular formula C28H29NSi2 and a molecular weight of 435.72 g/mol. Its IUPAC name is [2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-5-phenyl-3-pyridinyl]-trimethylsilane.
| Compound Name | [2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-5-phenyl-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 140720085 |
| Molecular Formula | C28H29NSi2 |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)-5-phenyl-3-pyridinyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc(-c2ccccc2)cnc1-c1ccc2c(c1)-c1ccccc1[Si]2(C)C |
| InChI | InChI=1S/C28H29NSi2/c1-30(2,3)27-18-22(20-11-7-6-8-12-20)19-29-28(27)21-15-16-26-24(17-21)23-13-9-10-14-25(23)31(26,4)5/h6-19H,1-5H3 |
| InChIKey | LUDKFRMGAXDPGI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|