C18H16OSi — CID 153288757
2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)furan (PubChem CID 153288757) has the molecular formula C18H16OSi and a molecular weight of 276.41 g/mol. Its IUPAC name is 2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)furan.
| Compound Name | 2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)furan |
|---|---|
| PubChem CID | 153288757 |
| Molecular Formula | C18H16OSi |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)furan |
| SMILES | C[Si]1(C)c2ccccc2-c2cc(-c3ccco3)ccc21 |
| InChI | InChI=1S/C18H16OSi/c1-20(2)17-8-4-3-6-14(17)15-12-13(9-10-18(15)20)16-7-5-11-19-16/h3-12H,1-2H3 |
| InChIKey | BJHWKFPPTFTAJR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|