C14H13ISi — CID 140829027
2-iodo-5,5-dimethylbenzo[b][1]benzosilole (PubChem CID 140829027) has the molecular formula C14H13ISi and a molecular weight of 336.25 g/mol. Its IUPAC name is 2-iodo-5,5-dimethylbenzo[b][1]benzosilole.
| Compound Name | 2-iodo-5,5-dimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 140829027 |
| Molecular Formula | C14H13ISi |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 2-iodo-5,5-dimethylbenzo[b][1]benzosilole |
| SMILES | C[Si]1(C)c2ccccc2-c2cc(I)ccc21 |
| InChI | InChI=1S/C14H13ISi/c1-16(2)13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9H,1-2H3 |
| InChIKey | DLTMRODSUWLCIQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|