C48H42Si3 — CID 59133577
4-[3,5-bis(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole (PubChem CID 59133577) has the molecular formula C48H42Si3 and a molecular weight of 703.12 g/mol. Its IUPAC name is 4-[3,5-bis(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole.
| Compound Name | 4-[3,5-bis(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 59133577 |
| Molecular Formula | C48H42Si3 |
| Molecular Weight | 703.12 g/mol |
| Exact Mass | 702.26 |
| IUPAC Name | 4-[3,5-bis(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole |
| SMILES | C[Si]1(C)c2ccccc2-c2cccc(-c3cc(-c4cccc5c4[Si](C)(C)c4ccccc4-5)cc(-c4cccc5c4[Si](C)(C)c4ccccc4-5)c3)c21 |
| InChI | InChI=1S/C48H42Si3/c1-49(2)43-25-10-7-16-37(43)40-22-13-19-34(46(40)49)31-28-32(35-20-14-23-41-38-17-8-11-26-44(38)50(3,4)47(35)41)30-33(29-31)36-21-15-24-42-39-18-9-12-27-45(39)51(5,6)48(36)42/h7-30H,1-6H3 |
| InChIKey | VLRJMUBNXSTUSA-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.12 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|