C44H35NSi — CID 176764642
N-[3-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-N-phenyl-3-(4-phenylphenyl)aniline (PubChem CID 176764642) has the molecular formula C44H35NSi and a molecular weight of 605.86 g/mol. Its IUPAC name is N-[3-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-N-phenyl-3-(4-phenylphenyl)aniline.
| Compound Name | N-[3-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-N-phenyl-3-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 176764642 |
| Molecular Formula | C44H35NSi |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | N-[3-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-N-phenyl-3-(4-phenylphenyl)aniline |
| SMILES | C[Si]1(C)c2ccccc2-c2cccc(-c3cccc(N(c4ccccc4)c4cccc(-c5ccc(-c6ccccc6)cc5)c4)c3)c21 |
| InChI | InChI=1S/C44H35NSi/c1-46(2)43-25-10-9-22-41(43)42-24-13-23-40(44(42)46)36-17-12-21-39(31-36)45(37-18-7-4-8-19-37)38-20-11-16-35(30-38)34-28-26-33(27-29-34)32-14-5-3-6-15-32/h3-31H,1-2H3 |
| InChIKey | QNPPJYJFQAJGKL-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|