C28H26OPSi2+ — CID 175408349
bis(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-oxophosphanium (PubChem CID 175408349) has the molecular formula C28H26OPSi2+ and a molecular weight of 465.66 g/mol. Its IUPAC name is bis(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-oxophosphanium.
| Compound Name | bis(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-oxophosphanium |
|---|---|
| PubChem CID | 175408349 |
| Molecular Formula | C28H26OPSi2+ |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | bis(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-oxophosphanium |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc([P+](=O)c3ccc4c(c3)[Si](C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C28H26OPSi2/c1-31(2)25-11-7-5-9-21(25)23-15-13-19(17-27(23)31)30(29)20-14-16-24-22-10-6-8-12-26(22)32(3,4)28(24)18-20/h5-18H,1-4H3/q+1 |
| InChIKey | NDGXMGXPPWUVKE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|