C42H38Si — CID 177091641
5,5-diphenyl-2,8-bis(2,4,6-trimethylphenyl)benzo[b][1]benzosilole (PubChem CID 177091641) has the molecular formula C42H38Si and a molecular weight of 570.85 g/mol. Its IUPAC name is 5,5-diphenyl-2,8-bis(2,4,6-trimethylphenyl)benzo[b][1]benzosilole.
| Compound Name | 5,5-diphenyl-2,8-bis(2,4,6-trimethylphenyl)benzo[b][1]benzosilole |
|---|---|
| PubChem CID | 177091641 |
| Molecular Formula | C42H38Si |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 5,5-diphenyl-2,8-bis(2,4,6-trimethylphenyl)benzo[b][1]benzosilole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)-c2cc(-c4c(C)cc(C)cc4C)ccc2[Si]3(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C42H38Si/c1-27-21-29(3)41(30(4)22-27)33-17-19-39-37(25-33)38-26-34(42-31(5)23-28(2)24-32(42)6)18-20-40(38)43(39,35-13-9-7-10-14-35)36-15-11-8-12-16-36/h7-26H,1-6H3 |
| InChIKey | HDGNFTCCAFWHLE-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|