C31H30Ti — CID 174651733
3,6-bis(2,4,6-trimethylphenyl)-9H-fluorene;titanium (PubChem CID 174651733) has the molecular formula C31H30Ti and a molecular weight of 450.45 g/mol. Its IUPAC name is 3,6-bis(2,4,6-trimethylphenyl)-9H-fluorene;titanium.
| Compound Name | 3,6-bis(2,4,6-trimethylphenyl)-9H-fluorene;titanium |
|---|---|
| PubChem CID | 174651733 |
| Molecular Formula | C31H30Ti |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3,6-bis(2,4,6-trimethylphenyl)-9H-fluorene;titanium |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)-c2cc(-c4c(C)cc(C)cc4C)ccc2C3)c(C)c1.[Ti] |
| InChI | InChI=1S/C31H30.Ti/c1-18-11-20(3)30(21(4)12-18)26-9-7-24-15-25-8-10-27(17-29(25)28(24)16-26)31-22(5)13-19(2)14-23(31)6;/h7-14,16-17H,15H2,1-6H3; |
| InChIKey | YRBCXJHVACBBJX-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |