C70H58N2 — CID 175636434
3-[6-[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-9H-fluoren-3-yl]-9-phenyl-6-(2,4,6-trimethylphenyl)carbazole (PubChem CID 175636434) has the molecular formula C70H58N2 and a molecular weight of 927.25 g/mol. Its IUPAC name is 3-[6-[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-9H-fluoren-3-yl]-9-phenyl-6-(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 3-[6-[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-9H-fluoren-3-yl]-9-phenyl-6-(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 175636434 |
| Molecular Formula | C70H58N2 |
| Molecular Weight | 927.25 g/mol |
| Exact Mass | 926.46 |
| IUPAC Name | 3-[6-[3,6-bis(2,4,6-trimethylphenyl)carbazol-9-yl]-9H-fluoren-3-yl]-9-phenyl-6-(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2cc(-c4ccc5c(c4)-c4cc(-n6c7ccc(-c8c(C)cc(C)cc8C)cc7c7cc(-c8c(C)cc(C)cc8C)ccc76)ccc4C5)ccc2n3-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C70H58N2/c1-40-27-43(4)68(44(5)28-40)53-19-24-65-61(36-53)60-35-50(18-23-64(60)71(65)56-13-11-10-12-14-56)49-15-16-51-33-52-17-22-57(39-59(52)58(51)34-49)72-66-25-20-54(69-45(6)29-41(2)30-46(69)7)37-62(66)63-38-55(21-26-67(63)72)70-47(8)31-42(3)32-48(70)9/h10-32,34-39H,33H2,1-9H3 |
| InChIKey | AVJHYCAVOCKHET-UHFFFAOYSA-N |
| XLogP | 18.90 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.25 |
| LogP ≤ 5 | 18.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |