C19H24 — CID 91665788
2-(3,4-diethylphenyl)-1,3,5-trimethylbenzene (PubChem CID 91665788) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-(3,4-diethylphenyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(3,4-diethylphenyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 91665788 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2-(3,4-diethylphenyl)-1,3,5-trimethylbenzene |
| SMILES | CCc1ccc(-c2c(C)cc(C)cc2C)cc1CC |
| InChI | InChI=1S/C19H24/c1-6-16-8-9-18(12-17(16)7-2)19-14(4)10-13(3)11-15(19)5/h8-12H,6-7H2,1-5H3 |
| InChIKey | KXDNPANIUQTPDU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |