C52H50N4OSi — CID 140831990
2-[4-[3-carbazol-9-yl-5-[4-(2-methylpropyl)-5-trimethylsilyl-2-pyridinyl]phenyl]-1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]phenol (PubChem CID 140831990) has the molecular formula C52H50N4OSi and a molecular weight of 775.09 g/mol. Its IUPAC name is 2-[4-[3-carbazol-9-yl-5-[4-(2-methylpropyl)-5-trimethylsilyl-2-pyridinyl]phenyl]-1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]phenol.
| Compound Name | 2-[4-[3-carbazol-9-yl-5-[4-(2-methylpropyl)-5-trimethylsilyl-2-pyridinyl]phenyl]-1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 140831990 |
| Molecular Formula | C52H50N4OSi |
| Molecular Weight | 775.09 g/mol |
| Exact Mass | 774.38 |
| IUPAC Name | 2-[4-[3-carbazol-9-yl-5-[4-(2-methylpropyl)-5-trimethylsilyl-2-pyridinyl]phenyl]-1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]phenol |
| SMILES | Cc1cc(C)c(-n2c(-c3ccccc3O)nc3c(-c4cc(-c5cc(CC(C)C)c([Si](C)(C)C)cn5)cc(-n5c6ccccc6c6ccccc65)c4)cccc32)c(C)c1 |
| InChI | InChI=1S/C52H50N4OSi/c1-32(2)24-38-30-44(53-31-49(38)58(6,7)8)37-27-36(28-39(29-37)55-45-20-12-9-16-41(45)42-17-10-13-21-46(42)55)40-19-15-22-47-50(40)54-52(43-18-11-14-23-48(43)57)56(47)51-34(4)25-33(3)26-35(51)5/h9-23,25-32,57H,24H2,1-8H3 |
| InChIKey | LWOYQMQQRRMLAM-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.09 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|