C47H49N3OSi — CID 140833081
2-[4-[3-(3,5-ditert-butylphenyl)-5-(5-trimethylsilyl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol (PubChem CID 140833081) has the molecular formula C47H49N3OSi and a molecular weight of 700.02 g/mol. Its IUPAC name is 2-[4-[3-(3,5-ditert-butylphenyl)-5-(5-trimethylsilyl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol.
| Compound Name | 2-[4-[3-(3,5-ditert-butylphenyl)-5-(5-trimethylsilyl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 140833081 |
| Molecular Formula | C47H49N3OSi |
| Molecular Weight | 700.02 g/mol |
| Exact Mass | 699.36 |
| IUPAC Name | 2-[4-[3-(3,5-ditert-butylphenyl)-5-(5-trimethylsilyl-2-pyridinyl)phenyl]-1-phenylbenzimidazol-2-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc([Si](C)(C)C)cn3)cc(-c3cccc4c3nc(-c3ccccc3O)n4-c3ccccc3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H49N3OSi/c1-46(2,3)35-27-32(28-36(29-35)47(4,5)6)31-24-33(26-34(25-31)41-23-22-38(30-48-41)52(7,8)9)39-19-15-20-42-44(39)49-45(40-18-13-14-21-43(40)51)50(42)37-16-11-10-12-17-37/h10-30,51H,1-9H3 |
| InChIKey | OPQZHRGBPSNNAR-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.02 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|