C38H32N4OSi — CID 140864345
2-[1-phenyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]imidazo[4,5-c]pyridin-2-yl]phenol (PubChem CID 140864345) has the molecular formula C38H32N4OSi and a molecular weight of 588.79 g/mol. Its IUPAC name is 2-[1-phenyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]imidazo[4,5-c]pyridin-2-yl]phenol.
| Compound Name | 2-[1-phenyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]imidazo[4,5-c]pyridin-2-yl]phenol |
|---|---|
| PubChem CID | 140864345 |
| Molecular Formula | C38H32N4OSi |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 2-[1-phenyl-4-[3-phenyl-5-(5-trimethylsilyl-2-pyridinyl)phenyl]imidazo[4,5-c]pyridin-2-yl]phenol |
| SMILES | C[Si](C)(C)c1ccc(-c2cc(-c3ccccc3)cc(-c3nccc4c3nc(-c3ccccc3O)n4-c3ccccc3)c2)nc1 |
| InChI | InChI=1S/C38H32N4OSi/c1-44(2,3)31-18-19-33(40-25-31)28-22-27(26-12-6-4-7-13-26)23-29(24-28)36-37-34(20-21-39-36)42(30-14-8-5-9-15-30)38(41-37)32-16-10-11-17-35(32)43/h4-25,43H,1-3H3 |
| InChIKey | JTRLVFVZOKPVQR-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|