C17H22NSi — CID 140765379
CID 140765379 (PubChem CID 140765379) has the molecular formula C17H22NSi and a molecular weight of 268.46 g/mol.
| Compound Name | CID 140765379 |
|---|---|
| PubChem CID | 140765379 |
| Molecular Formula | C17H22NSi |
| Molecular Weight | 268.46 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | — |
| SMILES | CC(C)Cc1cc(-c2ccccc2)ncc1[Si](C)C |
| InChI | InChI=1S/C17H22NSi/c1-13(2)10-15-11-16(14-8-6-5-7-9-14)18-12-17(15)19(3)4/h5-9,11-13H,10H2,1-4H3 |
| InChIKey | XSLFQUZSRKYOKJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|