C17H23NSi — CID 159672658
deuterio-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-bis(trideuteriomethyl)silane (PubChem CID 159672658) has the molecular formula C17H23NSi and a molecular weight of 276.51 g/mol. Its IUPAC name is deuterio-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-bis(trideuteriomethyl)silane.
| Compound Name | deuterio-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-bis(trideuteriomethyl)silane |
|---|---|
| PubChem CID | 159672658 |
| Molecular Formula | C17H23NSi |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | deuterio-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]-bis(trideuteriomethyl)silane |
| SMILES | [2H]C([2H])([2H])[Si]([2H])(c1cnc(-c2ccccc2)cc1CC(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H23NSi/c1-13(2)10-15-11-16(14-8-6-5-7-9-14)18-12-17(15)19(3)4/h5-9,11-13,19H,10H2,1-4H3/i3D3,4D3,19D |
| InChIKey | YRLOTDJMEUQAJU-MAQMNSDVSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|