C27H25N — CID 162710408
2-[4-(2-deuteriopropan-2-yl)phenyl]-4-[dideuterio(phenyl)methyl]-5-phenylpyridine (PubChem CID 162710408) has the molecular formula C27H25N and a molecular weight of 366.52 g/mol. Its IUPAC name is 2-[4-(2-deuteriopropan-2-yl)phenyl]-4-[dideuterio(phenyl)methyl]-5-phenylpyridine.
| Compound Name | 2-[4-(2-deuteriopropan-2-yl)phenyl]-4-[dideuterio(phenyl)methyl]-5-phenylpyridine |
|---|---|
| PubChem CID | 162710408 |
| Molecular Formula | C27H25N |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[4-(2-deuteriopropan-2-yl)phenyl]-4-[dideuterio(phenyl)methyl]-5-phenylpyridine |
| SMILES | [2H]C(C)(C)c1ccc(-c2cc(C([2H])([2H])c3ccccc3)c(-c3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C27H25N/c1-20(2)22-13-15-24(16-14-22)27-18-25(17-21-9-5-3-6-10-21)26(19-28-27)23-11-7-4-8-12-23/h3-16,18-20H,17H2,1-2H3/i17D2,20D |
| InChIKey | HAGLGJPTRNUUSY-MQJAMPLLSA-N |
| XLogP | 7.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |