C17H23GeN — CID 156667549
[6-[4-(2-deuteriopropan-2-yl)phenyl]-3-pyridinyl]-trimethylgermane (PubChem CID 156667549) has the molecular formula C17H23GeN and a molecular weight of 314.99 g/mol. Its IUPAC name is [6-[4-(2-deuteriopropan-2-yl)phenyl]-3-pyridinyl]-trimethylgermane.
| Compound Name | [6-[4-(2-deuteriopropan-2-yl)phenyl]-3-pyridinyl]-trimethylgermane |
|---|---|
| PubChem CID | 156667549 |
| Molecular Formula | C17H23GeN |
| Molecular Weight | 314.99 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [6-[4-(2-deuteriopropan-2-yl)phenyl]-3-pyridinyl]-trimethylgermane |
| SMILES | [2H]C(C)(C)c1ccc(-c2ccc([Ge](C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C17H23GeN/c1-13(2)14-6-8-15(9-7-14)17-11-10-16(12-19-17)18(3,4)5/h6-13H,1-5H3/i13D |
| InChIKey | IEJIAPZBJGUPCE-YSOHJTORSA-N |
| XLogP | 4.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.99 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |