C20H27GeN — CID 166574987
[6-[4-(1-deuteriocyclohexyl)phenyl]-3-pyridinyl]-trimethylgermane (PubChem CID 166574987) has the molecular formula C20H27GeN and a molecular weight of 355.06 g/mol. Its IUPAC name is [6-[4-(1-deuteriocyclohexyl)phenyl]-3-pyridinyl]-trimethylgermane.
| Compound Name | [6-[4-(1-deuteriocyclohexyl)phenyl]-3-pyridinyl]-trimethylgermane |
|---|---|
| PubChem CID | 166574987 |
| Molecular Formula | C20H27GeN |
| Molecular Weight | 355.06 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [6-[4-(1-deuteriocyclohexyl)phenyl]-3-pyridinyl]-trimethylgermane |
| SMILES | [2H]C1(c2ccc(-c3ccc([Ge](C)(C)C)cn3)cc2)CCCCC1 |
| InChI | InChI=1S/C20H27GeN/c1-21(2,3)19-13-14-20(22-15-19)18-11-9-17(10-12-18)16-7-5-4-6-8-16/h9-16H,4-8H2,1-3H3/i16D |
| InChIKey | YDIYBTKRWMLPPS-QNLPYAOMSA-N |
| XLogP | 5.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.06 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |