C32H25NO — CID 162710557
5-(1-deuterio-1-phenylethyl)-2-dibenzofuran-2-yl-4-[dideuterio(phenyl)methyl]pyridine (PubChem CID 162710557) has the molecular formula C32H25NO and a molecular weight of 442.58 g/mol. Its IUPAC name is 5-(1-deuterio-1-phenylethyl)-2-dibenzofuran-2-yl-4-[dideuterio(phenyl)methyl]pyridine.
| Compound Name | 5-(1-deuterio-1-phenylethyl)-2-dibenzofuran-2-yl-4-[dideuterio(phenyl)methyl]pyridine |
|---|---|
| PubChem CID | 162710557 |
| Molecular Formula | C32H25NO |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 5-(1-deuterio-1-phenylethyl)-2-dibenzofuran-2-yl-4-[dideuterio(phenyl)methyl]pyridine |
| SMILES | [2H]C([2H])(c1ccccc1)c1cc(-c2ccc3oc4ccccc4c3c2)ncc1C([2H])(C)c1ccccc1 |
| InChI | InChI=1S/C32H25NO/c1-22(24-12-6-3-7-13-24)29-21-33-30(20-26(29)18-23-10-4-2-5-11-23)25-16-17-32-28(19-25)27-14-8-9-15-31(27)34-32/h2-17,19-22H,18H2,1H3/i18D2,22D |
| InChIKey | BOUFKLCTZYNZBU-UUIZYSOQSA-N |
| XLogP | 8.39 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |