C22H23N — CID 166503371
5-(2-deuteriopropan-2-yl)-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridine (PubChem CID 166503371) has the molecular formula C22H23N and a molecular weight of 305.46 g/mol. Its IUPAC name is 5-(2-deuteriopropan-2-yl)-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridine.
| Compound Name | 5-(2-deuteriopropan-2-yl)-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 166503371 |
| Molecular Formula | C22H23N |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 5-(2-deuteriopropan-2-yl)-2-[2-methyl-5-phenyl-4-(trideuteriomethyl)phenyl]pyridine |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2ccc(C([2H])(C)C)cn2)cc1-c1ccccc1 |
| InChI | InChI=1S/C22H23N/c1-15(2)19-10-11-22(23-14-19)21-13-20(16(3)12-17(21)4)18-8-6-5-7-9-18/h5-15H,1-4H3/i3D3,15D |
| InChIKey | XGVAGJUEQKXRFS-VWJHETFLSA-N |
| XLogP | 6.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |