C18H15N — CID 59546973
2-phenyl-5-[2-(trideuteriomethyl)phenyl]pyridine (PubChem CID 59546973) has the molecular formula C18H15N and a molecular weight of 248.34 g/mol. Its IUPAC name is 2-phenyl-5-[2-(trideuteriomethyl)phenyl]pyridine.
| Compound Name | 2-phenyl-5-[2-(trideuteriomethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 59546973 |
| Molecular Formula | C18H15N |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-phenyl-5-[2-(trideuteriomethyl)phenyl]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccccc1-c1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C18H15N/c1-14-7-5-6-10-17(14)16-11-12-18(19-13-16)15-8-3-2-4-9-15/h2-13H,1H3/i1D3 |
| InChIKey | GUJCNVFPPQAHFW-FIBGUPNXSA-N |
| XLogP | 4.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |