C42H30N2O — CID 126639001
1-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]ethanone (PubChem CID 126639001) has the molecular formula C42H30N2O and a molecular weight of 578.72 g/mol. Its IUPAC name is 1-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]ethanone.
| Compound Name | 1-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 126639001 |
| Molecular Formula | C42H30N2O |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 1-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccccc2-c2ccc(-c3ccccc3)nc2)cc(-c2ccccc2-c2ccc(-c3ccccc3)nc2)c1 |
| InChI | InChI=1S/C42H30N2O/c1-29(45)34-24-35(39-18-10-8-16-37(39)32-20-22-41(43-27-32)30-12-4-2-5-13-30)26-36(25-34)40-19-11-9-17-38(40)33-21-23-42(44-28-33)31-14-6-3-7-15-31/h2-28H,1H3 |
| InChIKey | YQAXOACIXOOKHN-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |