About CID 161384544
CID 161384544 (PubChem CID 161384544) has the molecular formula C69H63BN3
and a molecular weight of 945.10 g/mol.
Molecular Properties
| Compound Name | CID 161384544 |
| PubChem CID | 161384544 |
| Molecular Formula | C69H63BN3 |
| Molecular Weight | 945.10 g/mol |
| Exact Mass | 944.51 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccccc3-c3cc(-c4ccccc4-c4ccc(-c5ccc(C(C)(C)C)cc5)nc4)cc(-c4ccccc4-c4ccc(-c5ccc(C(C)(C)C)cc5)nc4)c3)cn2)cc1.[B] |
| InChI | InChI=1S/C69H63N3.B/c1-67(2,3)55-31-22-46(23-32-55)64-37-28-49(43-70-64)58-16-10-13-19-61(58)52-40-53(62-20-14-11-17-59(62)50-29-38-65(71-44-50)47-24-33-56(34-25-47)68(4,5)6)42-54(41-52)63-21-15-12-18-60(63)51-30-39-66(72-45-51)48-26-35-57(36-27-48)69(7,8)9;/h10-45H,1-9H3; |
| InChIKey | DXZRCOAGGQKAPU-UHFFFAOYSA-N |
| XLogP | 18.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 945.10 |
| LogP ≤ 5 | 18.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161384544 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161384544?
The IUPAC name of CID 161384544 (CID 161384544) is not available.
What is the SMILES notation for CID 161384544?
The canonical SMILES for CID 161384544 is CC(C)(C)c1ccc(-c2ccc(-c3ccccc3-c3cc(-c4ccccc4-c4ccc(-c5ccc(C(C)(C)C)cc5)nc4)cc(-c4ccccc4-c4ccc(-c5ccc(C(C)(C)C)cc5)nc4)c3)cn2)cc1.[B].
What is the InChIKey of CID 161384544?
The InChIKey is DXZRCOAGGQKAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C69H63N3.B/c1-67(2,3)55-31-22-46(23-32-55)64-37-28-49(43-70-64)58-16-10-13-19-61(58)52-40-53(62-20-14-11-17-59(62)50-29-38-65(71-44-50)47-24-33-56(34-25-47)68(4,5)6)42-54(41-52)63-21-15-12-18-60(63)51-30-39-66(72-45-51)48-26-35-57(36-27-48)69(7,8)9;/h10-45H,1-9H3;.
What are the key properties of CID 161384544?
CID 161384544 has a molecular weight of 945.10 g/mol, XLogP of 18.39, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161384544 is sourced from PubChem (CID 161384544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).