C69H63BN3 — CID 161384544
CID 161384544 (PubChem CID 161384544) has the molecular formula C69H63BN3 and a molecular weight of 945.10 g/mol.
| Compound Name | CID 161384544 |
|---|---|
| PubChem CID | 161384544 |
| Molecular Formula | C69H63BN3 |
| Molecular Weight | 945.10 g/mol |
| Exact Mass | 944.51 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccccc3-c3cc(-c4ccccc4-c4ccc(-c5ccc(C(C)(C)C)cc5)nc4)cc(-c4ccccc4-c4ccc(-c5ccc(C(C)(C)C)cc5)nc4)c3)cn2)cc1.[B] |
| InChI | InChI=1S/C69H63N3.B/c1-67(2,3)55-31-22-46(23-32-55)64-37-28-49(43-70-64)58-16-10-13-19-61(58)52-40-53(62-20-14-11-17-59(62)50-29-38-65(71-44-50)47-24-33-56(34-25-47)68(4,5)6)42-54(41-52)63-21-15-12-18-60(63)51-30-39-66(72-45-51)48-26-35-57(36-27-48)69(7,8)9;/h10-45H,1-9H3; |
| InChIKey | DXZRCOAGGQKAPU-UHFFFAOYSA-N |
| XLogP | 18.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.10 |
| LogP ≤ 5 | 18.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|