C52H40N2O2 — CID 137456988
(Z)-5-hydroxy-1-[2-[3-[2-(6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]hex-4-en-3-one (PubChem CID 137456988) has the molecular formula C52H40N2O2 and a molecular weight of 724.90 g/mol. Its IUPAC name is (Z)-5-hydroxy-1-[2-[3-[2-(6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]hex-4-en-3-one.
| Compound Name | (Z)-5-hydroxy-1-[2-[3-[2-(6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]hex-4-en-3-one |
|---|---|
| PubChem CID | 137456988 |
| Molecular Formula | C52H40N2O2 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | (Z)-5-hydroxy-1-[2-[3-[2-(6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-pyridin-2-ylphenyl)phenyl]phenyl]phenyl]hex-4-en-3-one |
| SMILES | C/C(O)=C/C(=O)CCc1ccccc1-c1cc(-c2ccccc2-c2ccc(-c3ccccn3)cc2)cc(-c2ccccc2-c2ccc(-c3ccccc3)nc2)c1 |
| InChI | InChI=1S/C52H40N2O2/c1-36(55)31-45(56)28-26-37-13-5-6-16-46(37)42-32-43(49-19-9-7-17-47(49)38-22-24-40(25-23-38)51-21-11-12-30-53-51)34-44(33-42)50-20-10-8-18-48(50)41-27-29-52(54-35-41)39-14-3-2-4-15-39/h2-25,27,29-35,55H,26,28H2,1H3/b36-31- |
| InChIKey | HYAFJDSDROVEQJ-WWIWEHRJSA-N |
| XLogP | 13.11 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|