C52H38IrN2O2-2 — CID 154588816
(Z)-1-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium (PubChem CID 154588816) has the molecular formula C52H38IrN2O2-2 and a molecular weight of 915.11 g/mol. Its IUPAC name is (Z)-1-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium.
| Compound Name | (Z)-1-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
|---|---|
| PubChem CID | 154588816 |
| Molecular Formula | C52H38IrN2O2-2 |
| Molecular Weight | 915.11 g/mol |
| Exact Mass | 915.26 |
| IUPAC Name | (Z)-1-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
| SMILES | C/C(O)=C/C(=O)CCc1ccccc1-c1cc(-c2ccccc2-c2c[c-]c(-c3ccccn3)cc2)cc(-c2ccccc2-c2c[c-]c(-c3ccccn3)cc2)c1.[Ir] |
| InChI | InChI=1S/C52H38N2O2.Ir/c1-36(55)32-45(56)29-28-37-12-2-3-13-46(37)42-33-43(49-16-6-4-14-47(49)38-20-24-40(25-21-38)51-18-8-10-30-53-51)35-44(34-42)50-17-7-5-15-48(50)39-22-26-41(27-23-39)52-19-9-11-31-54-52;/h2-24,26,30-35,55H,28-29H2,1H3;/q-2;/b36-32-; |
| InChIKey | OISQZDAPGSAGAG-UNVOKOJBSA-N |
| XLogP | 12.71 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.11 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|