C56H35IrN4 — CID 153320031
2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+) (PubChem CID 153320031) has the molecular formula C56H35IrN4 and a molecular weight of 956.14 g/mol. Its IUPAC name is 2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+).
| Compound Name | 2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+) |
|---|---|
| PubChem CID | 153320031 |
| Molecular Formula | C56H35IrN4 |
| Molecular Weight | 956.14 g/mol |
| Exact Mass | 956.25 |
| IUPAC Name | 2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+) |
| SMILES | [Ir+3].[c-]1cc(-c2ccccc2-c2cc(-c3ccccc3-c3c[c-]c(-c4ccccn4)cc3)cc(-c3ccccc3-c3c[c-]c(-c4ccccn4)cn3)c2)ccc1-c1ccccn1 |
| InChI | InChI=1S/C56H35N4.Ir/c1-3-15-49(47(13-1)39-22-26-41(27-23-39)53-19-7-10-32-57-53)44-35-45(50-16-4-2-14-48(50)40-24-28-42(29-25-40)54-20-8-11-33-58-54)37-46(36-44)51-17-5-6-18-52(51)56-31-30-43(38-60-56)55-21-9-12-34-59-55;/h1-26,28,31-38H;/q-3;+3 |
| InChIKey | JQEKLTJEDFSARM-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.14 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|