C62H37IrN4 — CID 153319864
2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-4H-benzo[f][1,7]phenanthrolin-4-ide;iridium(3+) (PubChem CID 153319864) has the molecular formula C62H37IrN4 and a molecular weight of 1030.22 g/mol. Its IUPAC name is 2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-4H-benzo[f][1,7]phenanthrolin-4-ide;iridium(3+).
| Compound Name | 2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-4H-benzo[f][1,7]phenanthrolin-4-ide;iridium(3+) |
|---|---|
| PubChem CID | 153319864 |
| Molecular Formula | C62H37IrN4 |
| Molecular Weight | 1030.22 g/mol |
| Exact Mass | 1030.26 |
| IUPAC Name | 2-[2-[3,5-bis[2-(4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-4H-benzo[f][1,7]phenanthrolin-4-ide;iridium(3+) |
| SMILES | [Ir+3].[c-]1cc(-c2ccccc2-c2cc(-c3ccccc3-c3c[c-]c(-c4ccccn4)cc3)cc(-c3ccccc3-c3c[c-]c4c5ncccc5c5ccccc5c4n3)c2)ccc1-c1ccccn1 |
| InChI | InChI=1S/C62H37N4.Ir/c1-3-16-50(48(14-1)41-25-29-43(30-26-41)58-23-9-11-35-63-58)45-38-46(51-17-4-2-15-49(51)42-27-31-44(32-28-42)59-24-10-12-36-64-59)40-47(39-45)52-18-5-7-20-54(52)60-34-33-57-61-55(22-13-37-65-61)53-19-6-8-21-56(53)62(57)66-60;/h1-29,31,34-40H;/q-3;+3 |
| InChIKey | OPMXWSZQGLCBFU-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.22 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|