C63H38IrN7 — CID 177070702
CID 177070702 (PubChem CID 177070702) has the molecular formula C63H38IrN7 and a molecular weight of 1088.28 g/mol.
| Compound Name | CID 177070702 |
|---|---|
| PubChem CID | 177070702 |
| Molecular Formula | C63H38IrN7 |
| Molecular Weight | 1088.28 g/mol |
| Exact Mass | 1088.30 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccnc2c3[c-]cc(-c4ccccc4-c4cc(-c5ccccc5-c5c[c-]c(-c6ccccn6)cc5)cc(-c5ccccc5-c5c[c-]c(-c6ccccn6)cc5)c4)cc3n3c4nccnc4nc3c12.[Ir+3] |
| InChI | InChI=1S/C63H38N7.Ir/c1-40-30-33-66-60-55-29-28-45(39-58(55)70-62(59(40)60)69-61-63(70)68-35-34-67-61)51-14-4-7-17-54(51)48-37-46(52-15-5-2-12-49(52)41-20-24-43(25-21-41)56-18-8-10-31-64-56)36-47(38-48)53-16-6-3-13-50(53)42-22-26-44(27-23-42)57-19-9-11-32-65-57;/h2-24,26,28,30-39H,1H3;/q-3;+3/i1D3; |
| InChIKey | MRILZRGHXFCULB-NIIDSAIPSA-N |
| XLogP | 14.81 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1088.28 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|