C59H40IrN5 — CID 164805401
CID 164805401 (PubChem CID 164805401) has the molecular formula C59H40IrN5 and a molecular weight of 1011.22 g/mol.
| Compound Name | CID 164805401 |
|---|---|
| PubChem CID | 164805401 |
| Molecular Formula | C59H40IrN5 |
| Molecular Weight | 1011.22 g/mol |
| Exact Mass | 1011.29 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2cc(CCc3c[c-]c(-c4ccccn4)cc3)cc(CCc3c[c-]c(-c4ccccn4)cc3)c2)c1-c1c[c-]c2c3nccc4c5ccccc5c5cnn(c2c1)c5c43.[Ir+3] |
| InChI | InChI=1S/C59H40N5.Ir/c1-38-9-8-12-47(56(38)45-27-28-51-55(36-45)64-59-52(37-63-64)49-11-3-2-10-48(49)50-29-32-62-58(51)57(50)59)46-34-41(17-15-39-19-23-43(24-20-39)53-13-4-6-30-60-53)33-42(35-46)18-16-40-21-25-44(26-22-40)54-14-5-7-31-61-54;/h2-14,19-23,25,27,29-37H,15-18H2,1H3;/q-3;+3 |
| InChIKey | RWAZSVDGJJWACQ-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.22 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|